C18H19N3 — CID 54610436
N-[(Z)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-ylideneamino]aniline (PubChem CID 54610436) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[(Z)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-ylideneamino]aniline.
| Compound Name | N-[(Z)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-ylideneamino]aniline |
|---|---|
| PubChem CID | 54610436 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-[(Z)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-ylideneamino]aniline |
| SMILES | c1ccc(N/N=C2/CCN3CCCc4cccc2c43)cc1 |
| InChI | InChI=1S/C18H19N3/c1-2-8-15(9-3-1)19-20-17-11-13-21-12-5-7-14-6-4-10-16(17)18(14)21/h1-4,6,8-10,19H,5,7,11-13H2/b20-17- |
| InChIKey | LRVUOQBWEVXAQG-JZJYNLBNSA-N |
| XLogP | 3.66 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|