About 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide
5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide (PubChem CID 54610690) has the molecular formula C9H17BrN4O2
and a molecular weight of 293.17 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide.
Molecular Properties
| Compound Name | 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide |
| PubChem CID | 54610690 |
| Molecular Formula | C9H17BrN4O2 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide |
| SMILES | Br.CN(C)CCNCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H16N4O2.BrH/c1-13(2)4-3-10-5-7-6-11-9(15)12-8(7)14;/h6,10H,3-5H2,1-2H3,(H2,11,12,14,15);1H |
| InChIKey | QSJJEDACGHMDDY-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide?
The IUPAC name of 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide (CID 54610690) is 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide.
What is the SMILES notation for 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide?
The canonical SMILES for 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide is Br.CN(C)CCNCc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide?
The InChIKey is QSJJEDACGHMDDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2.BrH/c1-13(2)4-3-10-5-7-6-11-9(15)12-8(7)14;/h6,10H,3-5H2,1-2H3,(H2,11,12,14,15);1H.
What are the key properties of 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide?
5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide has a molecular weight of 293.17 g/mol, XLogP of -0.71, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(dimethylamino)ethylamino]methyl]-1H-pyrimidine-2,4-dione;hydrobromide is sourced from PubChem (CID 54610690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).