About potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide
potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide (PubChem CID 54610878) has the molecular formula C8H6KN2O2+
and a molecular weight of 201.25 g/mol. Its IUPAC name is potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide.
Molecular Properties
| Compound Name | potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide |
| PubChem CID | 54610878 |
| Molecular Formula | C8H6KN2O2+ |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide |
| SMILES | N#C/C(c1ccccc1)=[N+](/[O-])O.[K+] |
| InChI | InChI=1S/C8H6N2O2.K/c9-6-8(10(11)12)7-4-2-1-3-5-7;/h1-5H,(H,11,12);/q;+1 |
| InChIKey | NXQJYGGAWNMIGC-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 70.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide?
The IUPAC name of potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide (CID 54610878) is potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide.
What is the SMILES notation for potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide?
The canonical SMILES for potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide is N#C/C(c1ccccc1)=[N+](/[O-])O.[K+].
What is the InChIKey of potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide?
The InChIKey is NXQJYGGAWNMIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.K/c9-6-8(10(11)12)7-4-2-1-3-5-7;/h1-5H,(H,11,12);/q;+1.
What are the key properties of potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide?
potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide has a molecular weight of 201.25 g/mol, XLogP of -2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-cyano-N-hydroxy-1-phenylmethanimine oxide is sourced from PubChem (CID 54610878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).