C9H6O5 — CID 54610979
(1R,2S,6S,7S)-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 54610979) has the molecular formula C9H6O5 and a molecular weight of 194.14 g/mol. Its IUPAC name is (1R,2S,6S,7S)-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | (1R,2S,6S,7S)-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 54610979 |
| Molecular Formula | C9H6O5 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (1R,2S,6S,7S)-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2OC1=O |
| InChI | InChI=1S/C9H6O5/c10-7-3-1-2-4(13-7)6-5(3)8(11)14-9(6)12/h1-6H/t3-,4+,5+,6-/m1/s1 |
| InChIKey | ZVBXEFYMEYABQW-DPYQTVNSSA-N |
| XLogP | -0.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|