C19H21N3O4 — CID 54611071
dimethyl (1S,2R,6S,7R)-5-phenyl-3,4,5-triazatricyclo[5.3.2.02,6]dodeca-3,11-diene-11,12-dicarboxylate (PubChem CID 54611071) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is dimethyl (1S,2R,6S,7R)-5-phenyl-3,4,5-triazatricyclo[5.3.2.02,6]dodeca-3,11-diene-11,12-dicarboxylate.
| Compound Name | dimethyl (1S,2R,6S,7R)-5-phenyl-3,4,5-triazatricyclo[5.3.2.02,6]dodeca-3,11-diene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 54611071 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | dimethyl (1S,2R,6S,7R)-5-phenyl-3,4,5-triazatricyclo[5.3.2.02,6]dodeca-3,11-diene-11,12-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2CCC[C@H]1[C@H]1[C@@H]2N=NN1c1ccccc1 |
| InChI | InChI=1S/C19H21N3O4/c1-25-18(23)14-12-9-6-10-13(15(14)19(24)26-2)17-16(12)20-21-22(17)11-7-4-3-5-8-11/h3-5,7-8,12-13,16-17H,6,9-10H2,1-2H3/t12-,13+,16+,17-/m0/s1 |
| InChIKey | VJUBMAIKLRQXPC-IXKJSCDLSA-N |
| XLogP | 2.68 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |