C29H39ClN2O9 — CID 54611074
(18E)-11-chloro-6,21-dihydroxy-12,15,20-trimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (PubChem CID 54611074) has the molecular formula C29H39ClN2O9 and a molecular weight of 595.09 g/mol. Its IUPAC name is (18E)-11-chloro-6,21-dihydroxy-12,15,20-trimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione.
| Compound Name | (18E)-11-chloro-6,21-dihydroxy-12,15,20-trimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
|---|---|
| PubChem CID | 54611074 |
| Molecular Formula | C29H39ClN2O9 |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | (18E)-11-chloro-6,21-dihydroxy-12,15,20-trimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(O)C1(C)OC1C(C)C1CC(O)(NC(=O)O1)C(OC)/C=C/C=C(C)C2OC |
| InChI | InChI=1S/C29H39ClN2O9/c1-15-9-8-10-22(38-6)29(36)14-20(40-27(35)31-29)16(2)26-28(3,41-26)21(33)13-23(34)32(4)18-11-17(25(15)39-7)12-19(37-5)24(18)30/h8-12,16,20-22,25-26,33,36H,13-14H2,1-7H3,(H,31,35)/b10-8+,15-9? |
| InChIKey | JEORPNZFJMPGPH-ZUQDCCCTSA-N |
| XLogP | 3.26 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|