C22H23F3N4O10 — CID 54611183
[5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate;2,2,2-trifluoroacetic acid (PubChem CID 54611183) has the molecular formula C22H23F3N4O10 and a molecular weight of 560.44 g/mol. Its IUPAC name is [5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54611183 |
| Molecular Formula | C22H23F3N4O10 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | [5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate;2,2,2-trifluoroacetic acid |
| SMILES | NCC(=O)OCN1C(=O)C2C3C=CC(C2C1=O)C1C2C(=O)N(COC(=O)CN)C(=O)C2C31.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N4O8.C2HF3O2/c21-3-9(25)31-5-23-17(27)13-7-1-2-8(14(13)18(23)28)12-11(7)15-16(12)20(30)24(19(15)29)6-32-10(26)4-22;3-2(4,5)1(6)7/h1-2,7-8,11-16H,3-6,21-22H2;(H,6,7) |
| InChIKey | WJGCBJYBDMLJDB-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 216.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|