C22H31N3O4S — CID 54611260
[(E)-[2-hydroxy-1-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)ethylidene]amino]thiourea (PubChem CID 54611260) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is [(E)-[2-hydroxy-1-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)ethylidene]amino]thiourea.
| Compound Name | [(E)-[2-hydroxy-1-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 54611260 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [(E)-[2-hydroxy-1-(17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl)ethylidene]amino]thiourea |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(=O)CC2(C)C1CCC2(O)/C(CO)=N/NC(N)=S |
| InChI | InChI=1S/C22H31N3O4S/c1-20-7-5-13(27)9-12(20)3-4-14-15-6-8-22(29,17(11-26)24-25-19(23)30)21(15,2)10-16(28)18(14)20/h9,14-15,18,26,29H,3-8,10-11H2,1-2H3,(H3,23,25,30)/b24-17+ |
| InChIKey | HZHPHOSIVXPAOR-JJIBRWJFSA-N |
| XLogP | 1.61 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|