C30H26BrN6+ — CID 54611300
(E)-1-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]-N-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]methanimine bromide (PubChem CID 54611300) has the molecular formula C30H26BrN6+ and a molecular weight of 550.48 g/mol. Its IUPAC name is (E)-1-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]-N-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]methanimine bromide.
| Compound Name | (E)-1-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]-N-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]methanimine bromide |
|---|---|
| PubChem CID | 54611300 |
| Molecular Formula | C30H26BrN6+ |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | (E)-1-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]-N-[(E)-[4-(1-methylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]methanimine bromide |
| SMILES | Cn1c(-c2ccc(/C=N/N=C/c3ccc(-c4c[n+]5ccccc5n4C)cc3)cc2)c[n+]2ccccc12.[Br-] |
| InChI | InChI=1S/C30H26N6.BrH/c1-33-27(21-35-17-5-3-7-29(33)35)25-13-9-23(10-14-25)19-31-32-20-24-11-15-26(16-12-24)28-22-36-18-6-4-8-30(36)34(28)2;/h3-22H,1-2H3;1H/q+2;/p-1/b31-19+,32-20+; |
| InChIKey | IBQBBVTYWBMCCX-IZXMOPRRSA-M |
| XLogP | 1.63 |
| TPSA | 42.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|