About 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride
2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride (PubChem CID 54611366) has the molecular formula C6H14ClN3O2S
and a molecular weight of 227.72 g/mol. Its IUPAC name is 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 54611366 |
| Molecular Formula | C6H14ClN3O2S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCCOC(=O)N(C)C |
| InChI | InChI=1S/C6H13N3O2S.ClH/c1-9(2)6(10)11-3-4-12-5(7)8;/h3-4H2,1-2H3,(H3,7,8);1H |
| InChIKey | RNEGTXQHIZXAHF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride (CID 54611366) is 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride is Cl.[H]/N=C(\N)SCCOC(=O)N(C)C.
What is the InChIKey of 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride?
The InChIKey is RNEGTXQHIZXAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2S.ClH/c1-9(2)6(10)11-3-4-12-5(7)8;/h3-4H2,1-2H3,(H3,7,8);1H.
What are the key properties of 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride?
2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride has a molecular weight of 227.72 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamimidoylsulfanylethyl N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 54611366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).