About sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one
sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one (PubChem CID 54611386) has the molecular formula C10H8N2NaO4+
and a molecular weight of 243.17 g/mol. Its IUPAC name is sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 54611386 |
| Molecular Formula | C10H8N2NaO4+ |
| Molecular Weight | 243.17 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one |
| SMILES | O=C1NC(c2ccccc2)C([N+](=O)[O-])=C1O.[Na+] |
| InChI | InChI=1S/C10H8N2O4.Na/c13-9-8(12(15)16)7(11-10(9)14)6-4-2-1-3-5-6;/h1-5,7,13H,(H,11,14);/q;+1 |
| InChIKey | IFKRZGMCHCLMHM-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.17 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one?
The IUPAC name of sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one (CID 54611386) is sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one is O=C1NC(c2ccccc2)C([N+](=O)[O-])=C1O.[Na+].
What is the InChIKey of sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one?
The InChIKey is IFKRZGMCHCLMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4.Na/c13-9-8(12(15)16)7(11-10(9)14)6-4-2-1-3-5-6;/h1-5,7,13H,(H,11,14);/q;+1.
What are the key properties of sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one?
sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one has a molecular weight of 243.17 g/mol, XLogP of -2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-hydroxy-3-nitro-2-phenyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 54611386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).