C20H26Cl3N3OS — CID 54611471
2-(4,5-dichloro-2-isothiocyanatophenyl)-N-methyl-N-[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide;hydrochloride (PubChem CID 54611471) has the molecular formula C20H26Cl3N3OS and a molecular weight of 462.87 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-isothiocyanatophenyl)-N-methyl-N-[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide;hydrochloride.
| Compound Name | 2-(4,5-dichloro-2-isothiocyanatophenyl)-N-methyl-N-[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 54611471 |
| Molecular Formula | C20H26Cl3N3OS |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-(4,5-dichloro-2-isothiocyanatophenyl)-N-methyl-N-[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide;hydrochloride |
| SMILES | CN(C(=O)Cc1cc(Cl)c(Cl)cc1N=C=S)[C@H]1CCCC[C@@H]1N1CCCC1.Cl |
| InChI | InChI=1S/C20H25Cl2N3OS.ClH/c1-24(18-6-2-3-7-19(18)25-8-4-5-9-25)20(26)11-14-10-15(21)16(22)12-17(14)23-13-27;/h10,12,18-19H,2-9,11H2,1H3;1H/t18-,19-;/m0./s1 |
| InChIKey | AVMOGIGMTJJPBN-HLRBRJAUSA-N |
| XLogP | 5.56 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|