About 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile
4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile (PubChem CID 54611473) has the molecular formula C22H15N3
and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile |
| PubChem CID | 54611473 |
| Molecular Formula | C22H15N3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2ccc(-c3cn4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C22H15N3/c23-15-19-8-6-17(7-9-19)4-5-18-10-12-20(13-11-18)21-16-25-14-2-1-3-22(25)24-21/h1-14,16H/b5-4+ |
| InChIKey | KYQLDLPWEDFZME-SNAWJCMRSA-N |
| XLogP | 5.04 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile?
The IUPAC name of 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile (CID 54611473) is 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile.
What is the SMILES notation for 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile?
The canonical SMILES for 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile is N#Cc1ccc(/C=C/c2ccc(-c3cn4ccccc4n3)cc2)cc1.
What is the InChIKey of 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile?
The InChIKey is KYQLDLPWEDFZME-SNAWJCMRSA-N. The full InChI is InChI=1S/C22H15N3/c23-15-19-8-6-17(7-9-19)4-5-18-10-12-20(13-11-18)21-16-25-14-2-1-3-22(25)24-21/h1-14,16H/b5-4+.
What are the key properties of 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile?
4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile has a molecular weight of 321.38 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(4-imidazo[1,2-a]pyridin-2-ylphenyl)ethenyl]benzonitrile is sourced from PubChem (CID 54611473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).