C18H21NO5 — CID 5461161
1-O-benzyl 2-O-methyl (2S,3aR,6S,7aR)-6-hydroxy-2,3,3a,6,7,7a-hexahydroindole-1,2-dicarboxylate (PubChem CID 5461161) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aR,6S,7aR)-6-hydroxy-2,3,3a,6,7,7a-hexahydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aR,6S,7aR)-6-hydroxy-2,3,3a,6,7,7a-hexahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 5461161 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aR,6S,7aR)-6-hydroxy-2,3,3a,6,7,7a-hexahydroindole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2C=C[C@@H](O)C[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H21NO5/c1-23-17(21)16-9-13-7-8-14(20)10-15(13)19(16)18(22)24-11-12-5-3-2-4-6-12/h2-8,13-16,20H,9-11H2,1H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | VLUFYRHENDTKLA-JJXSEGSLSA-N |
| XLogP | 1.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|