potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide

C4H6KN4O3+ — CID 54611628

IUPACpotassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide
SMILES[K+].[N-]=[N+]=CC(=O)NCC(=O)NO
InChIInChI=1S/C4H6N4O3.K/c5-7-2-3(9)6-1-4(10)8-11;/h2,11H,1H2,(H,6,9)(H,8,10);/q;+1
InChIKeyHJCMGQQGMRODMA-UHFFFAOYSA-N
MW197.21 g/mol
LogP-5.09
Rot. Bonds3

About potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide

potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide (PubChem CID 54611628) has the molecular formula C4H6KN4O3+ and a molecular weight of 197.21 g/mol. Its IUPAC name is potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide.

Molecular Properties

Compound Namepotassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide
PubChem CID54611628
Molecular FormulaC4H6KN4O3+
Molecular Weight197.21 g/mol
Exact Mass197.01
IUPAC Namepotassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide
SMILES[K+].[N-]=[N+]=CC(=O)NCC(=O)NO
InChIInChI=1S/C4H6N4O3.K/c5-7-2-3(9)6-1-4(10)8-11;/h2,11H,1H2,(H,6,9)(H,8,10);/q;+1
InChIKeyHJCMGQQGMRODMA-UHFFFAOYSA-N
XLogP-5.09
TPSA114.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.21
LogP ≤ 5-5.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide?
The IUPAC name of potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide (CID 54611628) is potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide.
What is the SMILES notation for potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide?
The canonical SMILES for potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide is [K+].[N-]=[N+]=CC(=O)NCC(=O)NO.
What is the InChIKey of potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide?
The InChIKey is HJCMGQQGMRODMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O3.K/c5-7-2-3(9)6-1-4(10)8-11;/h2,11H,1H2,(H,6,9)(H,8,10);/q;+1.
What are the key properties of potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide?
potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide has a molecular weight of 197.21 g/mol, XLogP of -5.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[(2-diazoacetyl)amino]-N-hydroxyacetamide is sourced from PubChem (CID 54611628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).