About 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride
5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride (PubChem CID 54611706) has the molecular formula C6H10ClNO2
and a molecular weight of 163.60 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride |
| PubChem CID | 54611706 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride |
| SMILES | CC1=NC(C(=O)O)CC1.Cl |
| InChI | InChI=1S/C6H9NO2.ClH/c1-4-2-3-5(7-4)6(8)9;/h5H,2-3H2,1H3,(H,8,9);1H |
| InChIKey | FUUDIAWJUMPFSD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride?
The IUPAC name of 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride (CID 54611706) is 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride?
The canonical SMILES for 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride is CC1=NC(C(=O)O)CC1.Cl.
What is the InChIKey of 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride?
The InChIKey is FUUDIAWJUMPFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.ClH/c1-4-2-3-5(7-4)6(8)9;/h5H,2-3H2,1H3,(H,8,9);1H.
What are the key properties of 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride?
5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride has a molecular weight of 163.60 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 54611706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).