2-(2,2-dimethylpropyl)guanidine;sulfuric acid

C6H17N3O4S — CID 54611771

IUPAC2-(2,2-dimethylpropyl)guanidine;sulfuric acid
SMILESCC(C)(C)CN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N3.H2O4S/c1-6(2,3)4-9-5(7)8;1-5(2,3)4/h4H2,1-3H3,(H4,7,8,9);(H2,1,2,3,4)
InChIKeyIAMLPUNMPXJYRZ-UHFFFAOYSA-N
MW227.29 g/mol
LogP-0.35
Rot. Bonds1

About 2-(2,2-dimethylpropyl)guanidine;sulfuric acid

2-(2,2-dimethylpropyl)guanidine;sulfuric acid (PubChem CID 54611771) has the molecular formula C6H17N3O4S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)guanidine;sulfuric acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropyl)guanidine;sulfuric acid
PubChem CID54611771
Molecular FormulaC6H17N3O4S
Molecular Weight227.29 g/mol
Exact Mass227.09
IUPAC Name2-(2,2-dimethylpropyl)guanidine;sulfuric acid
SMILESCC(C)(C)CN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C6H15N3.H2O4S/c1-6(2,3)4-9-5(7)8;1-5(2,3)4/h4H2,1-3H3,(H4,7,8,9);(H2,1,2,3,4)
InChIKeyIAMLPUNMPXJYRZ-UHFFFAOYSA-N
XLogP-0.35
TPSA139.00 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.29
LogP ≤ 5-0.35
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2,2-dimethylpropyl)guanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropyl)guanidine;sulfuric acid?
The IUPAC name of 2-(2,2-dimethylpropyl)guanidine;sulfuric acid (CID 54611771) is 2-(2,2-dimethylpropyl)guanidine;sulfuric acid.
What is the SMILES notation for 2-(2,2-dimethylpropyl)guanidine;sulfuric acid?
The canonical SMILES for 2-(2,2-dimethylpropyl)guanidine;sulfuric acid is CC(C)(C)CN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-(2,2-dimethylpropyl)guanidine;sulfuric acid?
The InChIKey is IAMLPUNMPXJYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3.H2O4S/c1-6(2,3)4-9-5(7)8;1-5(2,3)4/h4H2,1-3H3,(H4,7,8,9);(H2,1,2,3,4).
What are the key properties of 2-(2,2-dimethylpropyl)guanidine;sulfuric acid?
2-(2,2-dimethylpropyl)guanidine;sulfuric acid has a molecular weight of 227.29 g/mol, XLogP of -0.35, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropyl)guanidine;sulfuric acid is sourced from PubChem (CID 54611771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).