C11H16ClN4O4Pt+3 — CID 54611902
4-[2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione;platinum(4+);chloride (PubChem CID 54611902) has the molecular formula C11H16ClN4O4Pt+3 and a molecular weight of 498.80 g/mol. Its IUPAC name is 4-[2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione;platinum(4+);chloride.
| Compound Name | 4-[2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione;platinum(4+);chloride |
|---|---|
| PubChem CID | 54611902 |
| Molecular Formula | C11H16ClN4O4Pt+3 |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 4-[2-(3,5-dioxopiperazin-1-yl)propyl]piperazine-2,6-dione;platinum(4+);chloride |
| SMILES | CC(CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1.[Cl-].[Pt+4] |
| InChI | InChI=1S/C11H16N4O4.ClH.Pt/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14;;/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19);1H;/q;;+4/p-1 |
| InChIKey | UHAZOKVKLVJPAC-UHFFFAOYSA-M |
| XLogP | -5.71 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | -5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|