C21H18Br2N8O3 — CID 54611941
(4E,5Z)-4,5-bis[(6-bromoquinazolin-4-yl)hydrazinylidene]pentane-1,2,3-triol (PubChem CID 54611941) has the molecular formula C21H18Br2N8O3 and a molecular weight of 590.24 g/mol. Its IUPAC name is (4E,5Z)-4,5-bis[(6-bromoquinazolin-4-yl)hydrazinylidene]pentane-1,2,3-triol.
| Compound Name | (4E,5Z)-4,5-bis[(6-bromoquinazolin-4-yl)hydrazinylidene]pentane-1,2,3-triol |
|---|---|
| PubChem CID | 54611941 |
| Molecular Formula | C21H18Br2N8O3 |
| Molecular Weight | 590.24 g/mol |
| Exact Mass | 587.99 |
| IUPAC Name | (4E,5Z)-4,5-bis[(6-bromoquinazolin-4-yl)hydrazinylidene]pentane-1,2,3-triol |
| SMILES | OCC(O)C(O)C(/C=N\Nc1ncnc2ccc(Br)cc12)=N/Nc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C21H18Br2N8O3/c22-11-1-3-15-13(5-11)20(26-9-24-15)30-28-7-17(19(34)18(33)8-32)29-31-21-14-6-12(23)2-4-16(14)25-10-27-21/h1-7,9-10,18-19,32-34H,8H2,(H,24,26,30)(H,25,27,31)/b28-7-,29-17+ |
| InChIKey | BCYSHCNCOPMWBX-XJFZXDPTSA-N |
| XLogP | 2.68 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|