About diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide
diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide (PubChem CID 54612280) has the molecular formula C12H22I2N2Zn-2
and a molecular weight of 513.52 g/mol. Its IUPAC name is diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide.
Molecular Properties
| Compound Name | diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide |
| PubChem CID | 54612280 |
| Molecular Formula | C12H22I2N2Zn-2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 511.92 |
| IUPAC Name | diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide |
| SMILES | C1CCC(CCC2CCCC[N-]2)[N-]C1.I[Zn]I |
| InChI | InChI=1S/C12H22N2.2HI.Zn/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;;;/h11-12H,1-10H2;2*1H;/q-2;;;+2/p-2 |
| InChIKey | KEIOEKLWGGFWGT-UHFFFAOYSA-L |
| XLogP | 5.39 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide?
The IUPAC name of diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide (CID 54612280) is diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide.
What is the SMILES notation for diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide?
The canonical SMILES for diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide is C1CCC(CCC2CCCC[N-]2)[N-]C1.I[Zn]I.
What is the InChIKey of diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide?
The InChIKey is KEIOEKLWGGFWGT-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H22N2.2HI.Zn/c1-3-9-13-11(5-1)7-8-12-6-2-4-10-14-12;;;/h11-12H,1-10H2;2*1H;/q-2;;;+2/p-2.
What are the key properties of diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide?
diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide has a molecular weight of 513.52 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodozinc;2-(2-piperidin-1-id-2-ylethyl)piperidin-1-ide is sourced from PubChem (CID 54612280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).