C27H42N2O2 — CID 54612859
N-[(3S,10R,13S,17S)-10,13-dimethyl-17-[1-(methylamino)ethyl]-4-oxo-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]-3-methylbut-2-enamide (PubChem CID 54612859) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-[(3S,10R,13S,17S)-10,13-dimethyl-17-[1-(methylamino)ethyl]-4-oxo-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]-3-methylbut-2-enamide.
| Compound Name | N-[(3S,10R,13S,17S)-10,13-dimethyl-17-[1-(methylamino)ethyl]-4-oxo-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 54612859 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | N-[(3S,10R,13S,17S)-10,13-dimethyl-17-[1-(methylamino)ethyl]-4-oxo-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]-3-methylbut-2-enamide |
| SMILES | CNC(C)[C@H]1CCC2C3CC=C4C(=O)[C@@H](NC(=O)C=C(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H42N2O2/c1-16(2)15-24(30)29-23-12-14-27(5)21-11-13-26(4)19(17(3)28-6)9-10-20(26)18(21)7-8-22(27)25(23)31/h8,15,17-21,23,28H,7,9-14H2,1-6H3,(H,29,30)/t17?,18?,19-,20?,21?,23+,26-,27-/m1/s1 |
| InChIKey | CLUQFEVBBPGSGA-BGHBZWCOSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|