C44H70O4 — CID 54612896
ethyl 2-[(1Z,4R,9S,12R,17S,19Z,23E,27E)-27-(2-ethoxy-2-oxoethyl)-5,5,16,16-tetramethyl-24-tetracyclo[18.10.2.04,9.012,17]dotriaconta-1,19,23,27-tetraenyl]acetate (PubChem CID 54612896) has the molecular formula C44H70O4 and a molecular weight of 663.04 g/mol. Its IUPAC name is ethyl 2-[(1Z,4R,9S,12R,17S,19Z,23E,27E)-27-(2-ethoxy-2-oxoethyl)-5,5,16,16-tetramethyl-24-tetracyclo[18.10.2.04,9.012,17]dotriaconta-1,19,23,27-tetraenyl]acetate.
| Compound Name | ethyl 2-[(1Z,4R,9S,12R,17S,19Z,23E,27E)-27-(2-ethoxy-2-oxoethyl)-5,5,16,16-tetramethyl-24-tetracyclo[18.10.2.04,9.012,17]dotriaconta-1,19,23,27-tetraenyl]acetate |
|---|---|
| PubChem CID | 54612896 |
| Molecular Formula | C44H70O4 |
| Molecular Weight | 663.04 g/mol |
| Exact Mass | 662.53 |
| IUPAC Name | ethyl 2-[(1Z,4R,9S,12R,17S,19Z,23E,27E)-27-(2-ethoxy-2-oxoethyl)-5,5,16,16-tetramethyl-24-tetracyclo[18.10.2.04,9.012,17]dotriaconta-1,19,23,27-tetraenyl]acetate |
| SMILES | CCOC(=O)C/C1=C\CC/C2=C/C[C@@H]3[C@@H](CCCC3(C)C)CC[C@H]3CCCC(C)(C)[C@H]3C/C=C(/CC/C=C(\CC(=O)OCC)CC1)CC2 |
| InChI | InChI=1S/C44H70O4/c1-7-47-41(45)31-35-15-9-13-33-19-20-34(14-10-16-36(22-21-35)32-42(46)48-8-2)24-28-40-38(18-12-30-44(40,5)6)26-25-37-17-11-29-43(3,4)39(37)27-23-33/h15-16,23-24,37-40H,7-14,17-22,25-32H2,1-6H3/b33-23-,34-24-,35-15-,36-16-/t37-,38+,39+,40- |
| InChIKey | KHIOYNHPORWZIF-VTSFZHHASA-N |
| XLogP | 12.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.04 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|