C25H31NO3 — CID 5461310
methyl 4-[(R)-benzamido-[(1R,2R)-1,2-dipropylcyclopropyl]methyl]benzoate (PubChem CID 5461310) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is methyl 4-[(R)-benzamido-[(1R,2R)-1,2-dipropylcyclopropyl]methyl]benzoate.
| Compound Name | methyl 4-[(R)-benzamido-[(1R,2R)-1,2-dipropylcyclopropyl]methyl]benzoate |
|---|---|
| PubChem CID | 5461310 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | methyl 4-[(R)-benzamido-[(1R,2R)-1,2-dipropylcyclopropyl]methyl]benzoate |
| SMILES | CCC[C@@H]1C[C@@]1(CCC)[C@@H](NC(=O)c1ccccc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-4-9-21-17-25(21,16-5-2)22(26-23(27)19-10-7-6-8-11-19)18-12-14-20(15-13-18)24(28)29-3/h6-8,10-15,21-22H,4-5,9,16-17H2,1-3H3,(H,26,27)/t21-,22+,25-/m1/s1 |
| InChIKey | LFIYFXPKMKZBDY-OTNCWRBYSA-N |
| XLogP | 5.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |