C16H14N2O — CID 54613102
7-benzyl-4,5-dihydropyrrolo[3,4-g][1,2]benzoxazole (PubChem CID 54613102) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 7-benzyl-4,5-dihydropyrrolo[3,4-g][1,2]benzoxazole.
| Compound Name | 7-benzyl-4,5-dihydropyrrolo[3,4-g][1,2]benzoxazole |
|---|---|
| PubChem CID | 54613102 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 7-benzyl-4,5-dihydropyrrolo[3,4-g][1,2]benzoxazole |
| SMILES | c1ccc(Cn2cc3c(c2)-c2oncc2CC3)cc1 |
| InChI | InChI=1S/C16H14N2O/c1-2-4-12(5-3-1)9-18-10-14-7-6-13-8-17-19-16(13)15(14)11-18/h1-5,8,10-11H,6-7,9H2 |
| InChIKey | FCEPTYLBEZWNAC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |