C15H22F6N2O4S2 — CID 54613181
bis(trifluoromethylsulfonyl)azanide;1-octylpyridin-1-ium (PubChem CID 54613181) has the molecular formula C15H22F6N2O4S2 and a molecular weight of 472.47 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-octylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-octylpyridin-1-ium |
|---|---|
| PubChem CID | 54613181 |
| Molecular Formula | C15H22F6N2O4S2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-octylpyridin-1-ium |
| SMILES | CCCCCCCC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H22N.C2F6NO4S2/c1-2-3-4-5-6-8-11-14-12-9-7-10-13-14;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7,9-10,12-13H,2-6,8,11H2,1H3;/q+1;-1 |
| InChIKey | REYBKXICDFBMEW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|