C41H40N4O9S — CID 54613234
6,13-bis[2-[(2-methoxyphenyl)methylamino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;4-methylbenzenesulfonic acid (PubChem CID 54613234) has the molecular formula C41H40N4O9S and a molecular weight of 764.86 g/mol. Its IUPAC name is 6,13-bis[2-[(2-methoxyphenyl)methylamino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;4-methylbenzenesulfonic acid.
| Compound Name | 6,13-bis[2-[(2-methoxyphenyl)methylamino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54613234 |
| Molecular Formula | C41H40N4O9S |
| Molecular Weight | 764.86 g/mol |
| Exact Mass | 764.25 |
| IUPAC Name | 6,13-bis[2-[(2-methoxyphenyl)methylamino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;4-methylbenzenesulfonic acid |
| SMILES | COc1ccccc1CNCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCNCc1ccccc1OC)C3=O.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C34H32N4O6.C7H8O3S/c1-43-27-9-5-3-7-21(27)19-35-15-17-37-31(39)23-11-13-25-30-26(14-12-24(29(23)30)32(37)40)34(42)38(33(25)41)18-16-36-20-22-8-4-6-10-28(22)44-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-14,35-36H,15-20H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | UGTQQMWDKQVUJJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|