C29H35BrO6 — CID 54613248
[(4E)-4-[2-[3-(2-bromophenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-5-oxooxolan-3-yl] acetate (PubChem CID 54613248) has the molecular formula C29H35BrO6 and a molecular weight of 559.50 g/mol. Its IUPAC name is [(4E)-4-[2-[3-(2-bromophenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-5-oxooxolan-3-yl] acetate.
| Compound Name | [(4E)-4-[2-[3-(2-bromophenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-5-oxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 54613248 |
| Molecular Formula | C29H35BrO6 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [(4E)-4-[2-[3-(2-bromophenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-5-oxooxolan-3-yl] acetate |
| SMILES | C=C1CCC2C3(C)COC(c4ccccc4Br)OC3CCC2(C)C1C/C=C1/C(=O)OCC1OC(C)=O |
| InChI | InChI=1S/C29H35BrO6/c1-17-9-12-24-28(3,21(17)11-10-20-23(35-18(2)31)15-33-26(20)32)14-13-25-29(24,4)16-34-27(36-25)19-7-5-6-8-22(19)30/h5-8,10,21,23-25,27H,1,9,11-16H2,2-4H3/b20-10+ |
| InChIKey | HUAGMQRJUCSXRC-KEBDBYFISA-N |
| XLogP | 6.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|