About 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea
1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea (PubChem CID 54613280) has the molecular formula C15H9ClF3N3O3
and a molecular weight of 371.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea |
| PubChem CID | 54613280 |
| Molecular Formula | C15H9ClF3N3O3 |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1nc2ccc(OC(F)(F)F)cc2o1 |
| InChI | InChI=1S/C15H9ClF3N3O3/c16-8-1-3-9(4-2-8)20-13(23)22-14-21-11-6-5-10(7-12(11)24-14)25-15(17,18)19/h1-7H,(H2,20,21,22,23) |
| InChIKey | LNZCGFSWJRHEAM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea?
The IUPAC name of 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea (CID 54613280) is 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea.
What is the SMILES notation for 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea?
The canonical SMILES for 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea is O=C(Nc1ccc(Cl)cc1)Nc1nc2ccc(OC(F)(F)F)cc2o1.
What is the InChIKey of 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea?
The InChIKey is LNZCGFSWJRHEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClF3N3O3/c16-8-1-3-9(4-2-8)20-13(23)22-14-21-11-6-5-10(7-12(11)24-14)25-15(17,18)19/h1-7H,(H2,20,21,22,23).
What are the key properties of 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea?
1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea has a molecular weight of 371.70 g/mol, XLogP of 5.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]urea is sourced from PubChem (CID 54613280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).