C17H21N3O6S2 — CID 54613427
6,7-dimethoxy-1-(4-sulfamoylphenyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 54613427) has the molecular formula C17H21N3O6S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(4-sulfamoylphenyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 6,7-dimethoxy-1-(4-sulfamoylphenyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 54613427 |
| Molecular Formula | C17H21N3O6S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 6,7-dimethoxy-1-(4-sulfamoylphenyl)-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(S(N)(=O)=O)cc1)N(S(N)(=O)=O)CC2 |
| InChI | InChI=1S/C17H21N3O6S2/c1-25-15-9-12-7-8-20(28(19,23)24)17(14(12)10-16(15)26-2)11-3-5-13(6-4-11)27(18,21)22/h3-6,9-10,17H,7-8H2,1-2H3,(H2,18,21,22)(H2,19,23,24) |
| InChIKey | HSQVOQSOKMWWKB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |