C14H10N4O — CID 54613488
5-methoxy-8,9,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 54613488) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 5-methoxy-8,9,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 5-methoxy-8,9,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 54613488 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5-methoxy-8,9,15,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | COc1ccc2c(c1)nnc1c3cccnc3[nH]c21 |
| InChI | InChI=1S/C14H10N4O/c1-19-8-4-5-9-11(7-8)17-18-13-10-3-2-6-15-14(10)16-12(9)13/h2-7H,1H3,(H,15,16) |
| InChIKey | AOCIVXMWBPBAKU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |