C27H36N2O8 — CID 5461366
3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-(dimethylamino)-2-oxoethyl]-5a-(oxan-2-yloxy)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate (PubChem CID 5461366) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-(dimethylamino)-2-oxoethyl]-5a-(oxan-2-yloxy)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-(dimethylamino)-2-oxoethyl]-5a-(oxan-2-yloxy)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 5461366 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-(dimethylamino)-2-oxoethyl]-5a-(oxan-2-yloxy)-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(OC3CCCCO3)[C@H](CC(=O)N(C)C)[C@@H]3O[C@@H]3C[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H36N2O8/c1-28(2)22(30)13-18-24-20(36-24)14-21-27(18,37-23-11-7-8-12-34-23)15-19(25(31)33-3)29(21)26(32)35-16-17-9-5-4-6-10-17/h4-6,9-10,18-21,23-24H,7-8,11-16H2,1-3H3/t18-,19+,20-,21-,23?,24+,27-/m1/s1 |
| InChIKey | ZIWLQQVPUBZSLR-DDAVYCLVSA-N |
| XLogP | 2.49 |
| TPSA | 107.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|