C12H13N3O — CID 54613666
8,9-dimethyl-5,6-dihydro-1H-pyrrolo[3,4-h]quinazolin-2-one (PubChem CID 54613666) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 8,9-dimethyl-5,6-dihydro-1H-pyrrolo[3,4-h]quinazolin-2-one.
| Compound Name | 8,9-dimethyl-5,6-dihydro-1H-pyrrolo[3,4-h]quinazolin-2-one |
|---|---|
| PubChem CID | 54613666 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 8,9-dimethyl-5,6-dihydro-1H-pyrrolo[3,4-h]quinazolin-2-one |
| SMILES | Cc1c2c(cn1C)CCc1cnc(=O)[nH]c1-2 |
| InChI | InChI=1S/C12H13N3O/c1-7-10-9(6-15(7)2)4-3-8-5-13-12(16)14-11(8)10/h5-6H,3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | IKFLAWOPZUFNLB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |