C36H43NO7Si — CID 5461370
3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5a-hydroxy-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate (PubChem CID 5461370) has the molecular formula C36H43NO7Si and a molecular weight of 629.83 g/mol. Its IUPAC name is 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5a-hydroxy-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5a-hydroxy-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 5461370 |
| Molecular Formula | C36H43NO7Si |
| Molecular Weight | 629.83 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 3-O-benzyl 4-O-methyl (1aR,2aR,4S,5aR,6R,6aS)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5a-hydroxy-2,2a,4,5,6,6a-hexahydro-1aH-oxireno[2,3-f]indole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(O)[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]3O[C@@H]3C[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H43NO7Si/c1-35(2,3)45(26-16-10-6-11-17-26,27-18-12-7-13-19-27)43-21-20-28-32-30(44-32)22-31-36(28,40)23-29(33(38)41-4)37(31)34(39)42-24-25-14-8-5-9-15-25/h5-19,28-32,40H,20-24H2,1-4H3/t28-,29+,30-,31-,32+,36-/m1/s1 |
| InChIKey | YSKJPWOSSXLDRZ-ALBKOFEHSA-N |
| XLogP | 4.42 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|