About N-phenyltetrazolo[1,5-a]pyridin-8-amine
N-phenyltetrazolo[1,5-a]pyridin-8-amine (PubChem CID 54613714) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is N-phenyltetrazolo[1,5-a]pyridin-8-amine.
Molecular Properties
| Compound Name | N-phenyltetrazolo[1,5-a]pyridin-8-amine |
| PubChem CID | 54613714 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-phenyltetrazolo[1,5-a]pyridin-8-amine |
| SMILES | c1ccc(Nc2cccn3nnnc23)cc1 |
| InChI | InChI=1S/C11H9N5/c1-2-5-9(6-3-1)12-10-7-4-8-16-11(10)13-14-15-16/h1-8,12H |
| InChIKey | QMUXTIJWQDYTJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-phenyltetrazolo[1,5-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyltetrazolo[1,5-a]pyridin-8-amine?
The IUPAC name of N-phenyltetrazolo[1,5-a]pyridin-8-amine (CID 54613714) is N-phenyltetrazolo[1,5-a]pyridin-8-amine.
What is the SMILES notation for N-phenyltetrazolo[1,5-a]pyridin-8-amine?
The canonical SMILES for N-phenyltetrazolo[1,5-a]pyridin-8-amine is c1ccc(Nc2cccn3nnnc23)cc1.
What is the InChIKey of N-phenyltetrazolo[1,5-a]pyridin-8-amine?
The InChIKey is QMUXTIJWQDYTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c1-2-5-9(6-3-1)12-10-7-4-8-16-11(10)13-14-15-16/h1-8,12H.
What are the key properties of N-phenyltetrazolo[1,5-a]pyridin-8-amine?
N-phenyltetrazolo[1,5-a]pyridin-8-amine has a molecular weight of 211.23 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyltetrazolo[1,5-a]pyridin-8-amine is sourced from PubChem (CID 54613714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).