C20H21NO7 — CID 5461372
11-O-benzyl 12-O-methyl (1R,5R,10R,12S)-3-oxo-2,7-dioxa-11-azatetracyclo[8.3.0.01,5.06,8]tridecane-11,12-dicarboxylate (PubChem CID 5461372) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is 11-O-benzyl 12-O-methyl (1R,5R,10R,12S)-3-oxo-2,7-dioxa-11-azatetracyclo[8.3.0.01,5.06,8]tridecane-11,12-dicarboxylate.
| Compound Name | 11-O-benzyl 12-O-methyl (1R,5R,10R,12S)-3-oxo-2,7-dioxa-11-azatetracyclo[8.3.0.01,5.06,8]tridecane-11,12-dicarboxylate |
|---|---|
| PubChem CID | 5461372 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 11-O-benzyl 12-O-methyl (1R,5R,10R,12S)-3-oxo-2,7-dioxa-11-azatetracyclo[8.3.0.01,5.06,8]tridecane-11,12-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]23OC(=O)C[C@@H]2C2OC2C[C@H]3N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO7/c1-25-18(23)13-9-20-12(7-16(22)28-20)17-14(27-17)8-15(20)21(13)19(24)26-10-11-5-3-2-4-6-11/h2-6,12-15,17H,7-10H2,1H3/t12-,13+,14?,15-,17?,20-/m1/s1 |
| InChIKey | MUYOXLFZYAPMEI-OFUPQRIESA-N |
| XLogP | 1.41 |
| TPSA | 94.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|