C23H27NO7 — CID 5461375
7-O-benzyl 8-O-methyl (3aS,6aR,8S,9aR)-2,4-dioxo-5-propyl-3a,5,6,6a,8,9-hexahydro-3H-furo[2,3-d]indole-7,8-dicarboxylate (PubChem CID 5461375) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 7-O-benzyl 8-O-methyl (3aS,6aR,8S,9aR)-2,4-dioxo-5-propyl-3a,5,6,6a,8,9-hexahydro-3H-furo[2,3-d]indole-7,8-dicarboxylate.
| Compound Name | 7-O-benzyl 8-O-methyl (3aS,6aR,8S,9aR)-2,4-dioxo-5-propyl-3a,5,6,6a,8,9-hexahydro-3H-furo[2,3-d]indole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 5461375 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 7-O-benzyl 8-O-methyl (3aS,6aR,8S,9aR)-2,4-dioxo-5-propyl-3a,5,6,6a,8,9-hexahydro-3H-furo[2,3-d]indole-7,8-dicarboxylate |
| SMILES | CCCC1C[C@H]2N(C(=O)OCc3ccccc3)[C@H](C(=O)OC)C[C@]23OC(=O)C[C@@H]3C1=O |
| InChI | InChI=1S/C23H27NO7/c1-3-7-15-10-18-23(16(20(15)26)11-19(25)31-23)12-17(21(27)29-2)24(18)22(28)30-13-14-8-5-4-6-9-14/h4-6,8-9,15-18H,3,7,10-13H2,1-2H3/t15?,16-,17+,18-,23-/m1/s1 |
| InChIKey | RRDNSKOCWFTKAF-QMQFOIALSA-N |
| XLogP | 2.63 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|