About 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol
6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol (PubChem CID 54613758) has the molecular formula C26H27FO2S
and a molecular weight of 422.57 g/mol. Its IUPAC name is 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol.
Molecular Properties
| Compound Name | 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol |
| PubChem CID | 54613758 |
| Molecular Formula | C26H27FO2S |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol |
| SMILES | CCSCC1CC(O)(c2ccccc2)C(c2ccccc2)C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C26H27FO2S/c1-2-30-18-23-17-26(28,21-11-7-4-8-12-21)24(19-9-5-3-6-10-19)25(29-23)20-13-15-22(27)16-14-20/h3-16,23-25,28H,2,17-18H2,1H3 |
| InChIKey | FSXDGPMVZPSKCM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol?
The IUPAC name of 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol (CID 54613758) is 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol.
What is the SMILES notation for 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol?
The canonical SMILES for 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol is CCSCC1CC(O)(c2ccccc2)C(c2ccccc2)C(c2ccc(F)cc2)O1.
What is the InChIKey of 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol?
The InChIKey is FSXDGPMVZPSKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27FO2S/c1-2-30-18-23-17-26(28,21-11-7-4-8-12-21)24(19-9-5-3-6-10-19)25(29-23)20-13-15-22(27)16-14-20/h3-16,23-25,28H,2,17-18H2,1H3.
What are the key properties of 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol?
6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol has a molecular weight of 422.57 g/mol, XLogP of 6.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylsulfanylmethyl)-2-(4-fluorophenyl)-3,4-diphenyloxan-4-ol is sourced from PubChem (CID 54613758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).