C22H25N3O6 — CID 54613771
[(2R,3S,4R,5R)-5-azido-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 54613771) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-azido-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54613771 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-3-hydroxy-4,6-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OCc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C22H25N3O6/c1-15(26)28-14-18-20(27)21(29-12-16-8-4-2-5-9-16)19(24-25-23)22(31-18)30-13-17-10-6-3-7-11-17/h2-11,18-22,27H,12-14H2,1H3/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | NCHOEVQXSWGBLD-HDKZTWHISA-N |
| XLogP | 3.12 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|