C26H37NO8Si — CID 5461384
7-O-benzyl 8-O-methyl (3aR,4S,5R,8S,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-oxo-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate (PubChem CID 5461384) has the molecular formula C26H37NO8Si and a molecular weight of 519.67 g/mol. Its IUPAC name is 7-O-benzyl 8-O-methyl (3aR,4S,5R,8S,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-oxo-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate.
| Compound Name | 7-O-benzyl 8-O-methyl (3aR,4S,5R,8S,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-oxo-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 5461384 |
| Molecular Formula | C26H37NO8Si |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 7-O-benzyl 8-O-methyl (3aR,4S,5R,8S,9aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-oxo-3,3a,4,5,6,6a,8,9-octahydrofuro[2,3-d]indole-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]23OC(=O)C[C@@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)CC3N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H37NO8Si/c1-25(2,3)36(5,6)35-19-13-20-26(17(22(19)29)12-21(28)34-26)14-18(23(30)32-4)27(20)24(31)33-15-16-10-8-7-9-11-16/h7-11,17-20,22,29H,12-15H2,1-6H3/t17-,18+,19-,20?,22+,26-/m1/s1 |
| InChIKey | MVCIFOHGFJWMRS-QYLLLMKASA-N |
| XLogP | 3.40 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|