C27H36N4O6 — CID 54613874
3-(1,3-benzodioxol-5-yl)-1-[[(2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methylurea (PubChem CID 54613874) has the molecular formula C27H36N4O6 and a molecular weight of 512.61 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[[(2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methylurea.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[[(2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 54613874 |
| Molecular Formula | C27H36N4O6 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[[(2R,3R)-9-(dimethylamino)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-1-methylurea |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)Cc2cc(N(C)C)ccc2O[C@H]1CN(C)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H36N4O6/c1-17-13-31(18(2)15-32)26(33)11-19-10-21(29(3)4)7-9-22(19)37-25(17)14-30(5)27(34)28-20-6-8-23-24(12-20)36-16-35-23/h6-10,12,17-18,25,32H,11,13-16H2,1-5H3,(H,28,34)/t17-,18+,25+/m1/s1 |
| InChIKey | UVGUUEZCVXVZPI-UZEJHQAJSA-N |
| XLogP | 2.79 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|