C26H37NO7Si — CID 5461398
6-O-benzyl 7-O-methyl (3aR,5aR,7S,8aR,8bR)-2-oxo-4-propyl-8a-trimethylsilyloxy-1,3a,4,5,5a,7,8,8b-octahydrofuro[3,2-e]indole-6,7-dicarboxylate (PubChem CID 5461398) has the molecular formula C26H37NO7Si and a molecular weight of 503.67 g/mol. Its IUPAC name is 6-O-benzyl 7-O-methyl (3aR,5aR,7S,8aR,8bR)-2-oxo-4-propyl-8a-trimethylsilyloxy-1,3a,4,5,5a,7,8,8b-octahydrofuro[3,2-e]indole-6,7-dicarboxylate.
| Compound Name | 6-O-benzyl 7-O-methyl (3aR,5aR,7S,8aR,8bR)-2-oxo-4-propyl-8a-trimethylsilyloxy-1,3a,4,5,5a,7,8,8b-octahydrofuro[3,2-e]indole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 5461398 |
| Molecular Formula | C26H37NO7Si |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 6-O-benzyl 7-O-methyl (3aR,5aR,7S,8aR,8bR)-2-oxo-4-propyl-8a-trimethylsilyloxy-1,3a,4,5,5a,7,8,8b-octahydrofuro[3,2-e]indole-6,7-dicarboxylate |
| SMILES | CCCC1C[C@H]2N(C(=O)OCc3ccccc3)[C@H](C(=O)OC)C[C@@]2(O[Si](C)(C)C)[C@@H]2CC(=O)O[C@H]12 |
| InChI | InChI=1S/C26H37NO7Si/c1-6-10-18-13-21-26(34-35(3,4)5,19-14-22(28)33-23(18)19)15-20(24(29)31-2)27(21)25(30)32-16-17-11-8-7-9-12-17/h7-9,11-12,18-21,23H,6,10,13-16H2,1-5H3/t18?,19-,20+,21-,23-,26-/m1/s1 |
| InChIKey | HJJSISFOLMXTIY-FSORYLETSA-N |
| XLogP | 4.28 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|