About 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane
10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane (PubChem CID 546176) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane |
| PubChem CID | 546176 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane |
| SMILES | CC1(C)CC2(CCCNC2)CCO1 |
| InChI | InChI=1S/C11H21NO/c1-10(2)8-11(5-7-13-10)4-3-6-12-9-11/h12H,3-9H2,1-2H3 |
| InChIKey | MFJRYPCIMRMWLA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane?
The IUPAC name of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane (CID 546176) is 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane.
What is the SMILES notation for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane?
The canonical SMILES for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane is CC1(C)CC2(CCCNC2)CCO1.
What is the InChIKey of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane?
The InChIKey is MFJRYPCIMRMWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-10(2)8-11(5-7-13-10)4-3-6-12-9-11/h12H,3-9H2,1-2H3.
What are the key properties of 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane?
10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane has a molecular weight of 183.29 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-9-oxa-2-azaspiro[5.5]undecane is sourced from PubChem (CID 546176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).