C28H36N4O8S — CID 5461798
benzyl (2S)-3-methyl-2-[[(2S)-2-[[(E,2R,5S)-2-methyl-5-[(2-nitrophenyl)sulfonylamino]hex-3-enoyl]amino]propanoyl]amino]butanoate (PubChem CID 5461798) has the molecular formula C28H36N4O8S and a molecular weight of 588.68 g/mol. Its IUPAC name is benzyl (2S)-3-methyl-2-[[(2S)-2-[[(E,2R,5S)-2-methyl-5-[(2-nitrophenyl)sulfonylamino]hex-3-enoyl]amino]propanoyl]amino]butanoate.
| Compound Name | benzyl (2S)-3-methyl-2-[[(2S)-2-[[(E,2R,5S)-2-methyl-5-[(2-nitrophenyl)sulfonylamino]hex-3-enoyl]amino]propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 5461798 |
| Molecular Formula | C28H36N4O8S |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | benzyl (2S)-3-methyl-2-[[(2S)-2-[[(E,2R,5S)-2-methyl-5-[(2-nitrophenyl)sulfonylamino]hex-3-enoyl]amino]propanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](C)/C=C/[C@H](C)NS(=O)(=O)c1ccccc1[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36N4O8S/c1-18(2)25(28(35)40-17-22-11-7-6-8-12-22)30-27(34)21(5)29-26(33)19(3)15-16-20(4)31-41(38,39)24-14-10-9-13-23(24)32(36)37/h6-16,18-21,25,31H,17H2,1-5H3,(H,29,33)(H,30,34)/b16-15+/t19-,20+,21+,25+/m1/s1 |
| InChIKey | SAKHJZZMODEFGQ-JWONIRPRSA-N |
| XLogP | 2.84 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|