C15H18O2Se — CID 5461813
(3aS,7R,7aR)-3-methyl-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 5461813) has the molecular formula C15H18O2Se and a molecular weight of 309.27 g/mol. Its IUPAC name is (3aS,7R,7aR)-3-methyl-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aS,7R,7aR)-3-methyl-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 5461813 |
| Molecular Formula | C15H18O2Se |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (3aS,7R,7aR)-3-methyl-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | CC1C(=O)O[C@H]2[C@H]([Se]c3ccccc3)CCC[C@@H]12 |
| InChI | InChI=1S/C15H18O2Se/c1-10-12-8-5-9-13(14(12)17-15(10)16)18-11-6-3-2-4-7-11/h2-4,6-7,10,12-14H,5,8-9H2,1H3/t10?,12-,13+,14+/m0/s1 |
| InChIKey | CUJSMLRGTUUXRL-WTXCDKLGSA-N |
| XLogP | 2.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|