C27H36N2O4S — CID 54621690
(2S)-2-[(4R,5S)-5-[[benzyl(methyl)amino]methyl]-8-(cyclopenten-1-yl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54621690) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is (2S)-2-[(4R,5S)-5-[[benzyl(methyl)amino]methyl]-8-(cyclopenten-1-yl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4R,5S)-5-[[benzyl(methyl)amino]methyl]-8-(cyclopenten-1-yl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54621690 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (2S)-2-[(4R,5S)-5-[[benzyl(methyl)amino]methyl]-8-(cyclopenten-1-yl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C3=CCCC3)cc2O[C@@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C27H36N2O4S/c1-20-16-29(21(2)19-30)34(31,32)27-14-13-24(23-11-7-8-12-23)15-25(27)33-26(20)18-28(3)17-22-9-5-4-6-10-22/h4-6,9-11,13-15,20-21,26,30H,7-8,12,16-19H2,1-3H3/t20-,21+,26-/m1/s1 |
| InChIKey | FHRVLXHWRIRKLN-YZIHRLCOSA-N |
| XLogP | 4.15 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |