C26H36N2O4S — CID 54623896
(2S)-2-[(4R,5S)-5-[[cyclopropylmethyl(methyl)amino]methyl]-4-methyl-8-(4-methylphenyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54623896) has the molecular formula C26H36N2O4S and a molecular weight of 472.65 g/mol. Its IUPAC name is (2S)-2-[(4R,5S)-5-[[cyclopropylmethyl(methyl)amino]methyl]-4-methyl-8-(4-methylphenyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4R,5S)-5-[[cyclopropylmethyl(methyl)amino]methyl]-4-methyl-8-(4-methylphenyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54623896 |
| Molecular Formula | C26H36N2O4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (2S)-2-[(4R,5S)-5-[[cyclopropylmethyl(methyl)amino]methyl]-4-methyl-8-(4-methylphenyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | Cc1ccc(-c2ccc3c(c2)O[C@H](CN(C)CC2CC2)[C@H](C)CN([C@@H](C)CO)S3(=O)=O)cc1 |
| InChI | InChI=1S/C26H36N2O4S/c1-18-5-9-22(10-6-18)23-11-12-26-24(13-23)32-25(16-27(4)15-21-7-8-21)19(2)14-28(20(3)17-29)33(26,30)31/h5-6,9-13,19-21,25,29H,7-8,14-17H2,1-4H3/t19-,20+,25-/m1/s1 |
| InChIKey | QPTYATRKOYLKCJ-OHUGHZGNSA-N |
| XLogP | 3.77 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |