C24H29FN2O4S — CID 54625406
(2R)-2-[(4S,5R)-5-[(dimethylamino)methyl]-8-[2-(4-fluorophenyl)ethynyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54625406) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is (2R)-2-[(4S,5R)-5-[(dimethylamino)methyl]-8-[2-(4-fluorophenyl)ethynyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5R)-5-[(dimethylamino)methyl]-8-[2-(4-fluorophenyl)ethynyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54625406 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2R)-2-[(4S,5R)-5-[(dimethylamino)methyl]-8-[2-(4-fluorophenyl)ethynyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)C)Oc2cc(C#Cc3ccc(F)cc3)ccc2S1(=O)=O |
| InChI | InChI=1S/C24H29FN2O4S/c1-17-14-27(18(2)16-28)32(29,30)24-12-9-20(6-5-19-7-10-21(25)11-8-19)13-22(24)31-23(17)15-26(3)4/h7-13,17-18,23,28H,14-16H2,1-4H3/t17-,18+,23-/m0/s1 |
| InChIKey | WRJDHBFDXBLPSV-IXFSTUDKSA-N |
| XLogP | 2.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|