C28H37N3O6S — CID 54625976
1-[[(4R,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea (PubChem CID 54625976) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is 1-[[(4R,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[[(4R,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 54625976 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 1-[[(4R,5R)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-pent-1-ynyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea |
| SMILES | CCCC#Cc1ccc2c(c1)O[C@@H](CN(C)C(=O)Nc1ccc(OC)cc1)[C@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C28H37N3O6S/c1-6-7-8-9-22-10-15-27-25(16-22)37-26(20(2)17-31(21(3)19-32)38(27,34)35)18-30(4)28(33)29-23-11-13-24(36-5)14-12-23/h10-16,20-21,26,32H,6-7,17-19H2,1-5H3,(H,29,33)/t20-,21-,26+/m1/s1 |
| InChIKey | PTUAROKZNUZPKY-YPCDYVTLSA-N |
| XLogP | 3.78 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|