About ethylazanium;N-ethylcarbamodithioate
ethylazanium;N-ethylcarbamodithioate (PubChem CID 5462691) has the molecular formula C5H14N2S2
and a molecular weight of 166.31 g/mol. Its IUPAC name is ethylazanium;N-ethylcarbamodithioate.
Molecular Properties
| Compound Name | ethylazanium;N-ethylcarbamodithioate |
| PubChem CID | 5462691 |
| Molecular Formula | C5H14N2S2 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | ethylazanium;N-ethylcarbamodithioate |
| SMILES | CCNC(=S)[S-].CC[NH3+] |
| InChI | InChI=1S/C3H7NS2.C2H7N/c1-2-4-3(5)6;1-2-3/h2H2,1H3,(H2,4,5,6);2-3H2,1H3 |
| InChIKey | XSBNNDUUIRIBKE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze ethylazanium;N-ethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylazanium;N-ethylcarbamodithioate?
The IUPAC name of ethylazanium;N-ethylcarbamodithioate (CID 5462691) is ethylazanium;N-ethylcarbamodithioate.
What is the SMILES notation for ethylazanium;N-ethylcarbamodithioate?
The canonical SMILES for ethylazanium;N-ethylcarbamodithioate is CCNC(=S)[S-].CC[NH3+].
What is the InChIKey of ethylazanium;N-ethylcarbamodithioate?
The InChIKey is XSBNNDUUIRIBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NS2.C2H7N/c1-2-4-3(5)6;1-2-3/h2H2,1H3,(H2,4,5,6);2-3H2,1H3.
What are the key properties of ethylazanium;N-ethylcarbamodithioate?
ethylazanium;N-ethylcarbamodithioate has a molecular weight of 166.31 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylazanium;N-ethylcarbamodithioate is sourced from PubChem (CID 5462691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).