C28H33N3O2 — CID 5462751
[(E)-5-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)-2-methylpent-2-enyl] N-(4-phenyldiazenylphenyl)carbamate (PubChem CID 5462751) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is [(E)-5-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)-2-methylpent-2-enyl] N-(4-phenyldiazenylphenyl)carbamate.
| Compound Name | [(E)-5-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)-2-methylpent-2-enyl] N-(4-phenyldiazenylphenyl)carbamate |
|---|---|
| PubChem CID | 5462751 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | [(E)-5-(2,3-dimethyl-3-tricyclo[2.2.1.02,6]heptanyl)-2-methylpent-2-enyl] N-(4-phenyldiazenylphenyl)carbamate |
| SMILES | C/C(=C\CCC1(C)C2CC3C(C2)C31C)COC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N3O2/c1-19(8-7-15-27(2)20-16-24-25(17-20)28(24,27)3)18-33-26(32)29-21-11-13-23(14-12-21)31-30-22-9-5-4-6-10-22/h4-6,8-14,20,24-25H,7,15-18H2,1-3H3,(H,29,32)/b19-8+,31-30+ |
| InChIKey | YZHGYPCCSDHJCK-OSSRRNDQSA-N |
| XLogP | 8.06 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|